RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1093 |
| Common Name | Xanthosine |
| Formula | C10H12N4O6 |
| Formula at pH 7.2 (Predicted) | C10H12N4O6 |
| Molecular Weight | 284.226 |
| Structure |  |
| SMILES | c1(c2(c([nH]c([nH]1)=O)n(cn2)[CH]3([CH](O)[CH](O)[CH](O3)CO)))(=O) |
| Reactions | OSR0501 OSR0535 OSR0634 OSR0639 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C01762 |
| ChEBI | 18107 |