RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1094 |
| Common Name | Deoxyguanosine |
| Synonyms Names | 2'-Deoxyguanosine |
| Formula | C10H13N5O4 |
| Formula at pH 7.2 (Predicted) | C10H13N5O4 |
| Molecular Weight | 267.241 |
| Structure |  |
| SMILES | OCC1OC(CC1O)n1cnc2c1[nH]c(N)nc2=O |
| Reactions | OSR0626 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00330 |
| ChEBI | 17172 |
| Pubchem Compound | 187790 |
| Pubchem Substance | 3624 |