RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1096 |
| Common Name | Nicotinate D-ribonucleoside |
| Formula | C11H14NO6 |
| Formula at pH 7.2 (Predicted) | C11H13NO6 |
| Molecular Weight | 256.232 |
| Structure |  |
| SMILES | c2([n+1]([CH]1(O[CH](CO)[CH](O)[CH]1O))cccc2C(=O)O) |
| Reactions | OSR0618 OSR0637 OSR1391 |
| Pathways | |
|---|---|
| KEGG | rn00760 |
| Database Links | |
|---|---|
| Gramene | CPD-8259 |
| KEGG | C05841 |
| ChEBI | 27748 |
| Pubchem Compound | 161234 |
| Pubchem Substance | 8134 |