RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1103 |
| Common Name | (R)-5-Diphosphomevalonate |
| Formula | C6H14O10P2 |
| Formula at pH 7.2 (Predicted) | C6H11O10P23- |
| Molecular Weight | 308.117 |
| Structure |  |
| SMILES | CC(CC(=O)O)(O)CCOP(O)(=O)OP(O)(=O)O |
| Reactions | OSR1263 OSR1382 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | PWY-922 |
| Database Links | |
|---|---|
| Gramene | CPD-641 |
| KEGG | C01143 |
| ChEBI | 15899 |
| Pubchem Compound | 439418 |
| Pubchem Substance | 4374 |