RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1107 |
| Common Name | Pantothenate |
| Synonyms Names | Pantothenic acid ;(R)-Pantothenate |
| Formula | C9H17NO5 |
| Formula at pH 7.2 (Predicted) | C9H16NO5- |
| Molecular Weight | 219.235 |
| Structure |  |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(O)=O |
| Reactions | OSR0456 OSR1388 OSR2423 |
| Pathways | |
|---|---|
| KEGG | rn00770 rn01100 rn00410 rn01110 |
| Metacyc | PWY-3961 COA-PWY PWY-3921 PANTO-PWY |
| Database Links | |
|---|---|
| KEGG | C00864 |