RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1108 |
| Common Name | Biotin |
| Synonyms Names | D-Biotin ;Vitamin H ;Coenzyme R |
| Formula | C10H16N2O3S |
| Formula at pH 7.2 (Predicted) | C10H15N2O3S- |
| Molecular Weight | 244.311 |
| Structure |  |
| SMILES | C1(SC([CH]2([CH]1NC(N2)=O))CCCCC(O)=O) |
| Reactions | OSR0475 OSR1491 OSR2789 |
| Pathways | |
|---|---|
| KEGG | rn00780 rn01100 |
| Metacyc | PWY-3701 BIOTIN-SYNTHESIS-PWY PWY0-1264 |
| Database Links | |
|---|---|
| KEGG | C00120 |
| ChEBI | 15956 |