RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1110 |
| Common Name | N2-Acetyl-L-aminoadipyl-delta-phosphate |
| Formula | C8H14NO8P |
| Formula at pH 7.2 (Predicted) | C8H11NO8P3- |
| Molecular Weight | 283.172 |
| Structure |  |
| SMILES | CC(=O)NC(C(O)=O)CCCC(=O)OP(O)(O)=O |
| Reactions | OSR1269 OSR2110 |
| Database Links | |
|---|---|
| KEGG | C12987 |
| ChEBI | 31887 |
| Pubchem Compound | 443993 |
| Pubchem Substance | 583376 |