RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1117 |
| Common Name | Myricetin |
| Synonyms Names | 3,5,7,3',4',5'-Hexahydroxyflavone |
| Formula | C15H10O8 |
| Formula at pH 7.2 (Predicted) | C15H8O82- |
| Molecular Weight | 318.235 |
| Structure |  |
| SMILES | Oc1cc(O)c2c(c1)oc(c(c2=O)O)c1cc(O)c(c(c1)O)O |
| Reactions | OSR0887 OSR1471 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn00944 |
| Metacyc | PWY-5391 |
| Database Links | |
|---|---|
| KEGG | C10107 |
| ChEBI | 18152 |
| Pubchem Compound | 5281672 |
| Pubchem Substance | 12293 |