RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1119 |
| Common Name | Dihydrokaempferol |
| Synonyms Names | Aromadendrin ;(+)-Dihydrokaempferol ;(+)-Aromadendrin |
| Formula | C15H12O6 |
| Formula at pH 7.2 (Predicted) | C15H12O6 |
| Molecular Weight | 288.252 |
| Structure |  |
| SMILES | c1(cc(ccc(O)1)C2(C(O)C(=O)c3(c(O)cc(O)cc(O2)3))) |
| Reactions | OSR0795 OSR0808 OSR0813 OSR0881 OSR2148 OSR2197 OSR2205 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00941 rn01100 rn00944 |
| Metacyc | PWY1F-FLAVSYN PWY-5152 PWY1F-823 PWY-5059 PWY-3101 PWY-5060 |
| Database Links | |
|---|---|
| KEGG | C00974 |
| ChEBI | 15401 |