RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1123 |
| Common Name | Eriodictyol chalcone |
| Synonyms Names | 2',3,4,4',6'-Pentahydroxychalcone |
| Formula | C15H12O6 |
| Formula at pH 7.2 (Predicted) | C15H12O6 |
| Molecular Weight | 288.252 |
| Structure |  |
| SMILES | Oc1cc(O)c(c(c1)O)C(=O)C=Cc1ccc(c(c1)O)O |
| Reactions | OSR2714 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| KEGG | C15525 |
| ChEBI | 10836 |
| Pubchem Compound | 5461154 |
| Pubchem Substance | 17396517 |