RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1127 |
| Common Name | Eriodictyol |
| Formula | C15H12O6 |
| Formula at pH 7.2 (Predicted) | C15H12O6 |
| Molecular Weight | 288.252 |
| Structure |  |
| SMILES | c3(c2(OC(c1(ccc(O)c(O)c1))CC(=O)c2c(O)cc(O)3)) |
| Reactions | OSR0796 OSR0812 OSR2147 OSR2165 OSR2183 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00944 rn00941 rn01100 |
| Metacyc | PWY-3101 PWY-5152 PWY1F-823 PWY-5060 |
| Database Links | |
|---|---|
| Gramene | CPD-6994 |
| KEGG | C05631 |
| ChEBI | 28412 |
| Pubchem Compound | 440735 |
| Pubchem Substance | 7944 |