RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1128 |
| Common Name | Bisphenol A |
| Synonyms Names | 2,2-Bis(4-Hydroxyphenyl)propane |
| Formula | C15H16O2 |
| Formula at pH 7.2 (Predicted) | C15H16O2 |
| Molecular Weight | 228.286 |
| Structure |  |
| SMILES | CC(c1ccc(cc1)O)(c1ccc(cc1)O)C |
| Reactions | OSR2079 |
| Pathways | |
|---|---|
| KEGG | rn00363 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C13624 |
| ChEBI | 33216 |
| Pubchem Compound | 6623 |
| Pubchem Substance | 586242 |