RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1131 |
| Common Name | 2-hydroxyformononetin |
| Synonyms Names | 2'-hydroxyformononetin |
| Formula | C16H12O5 |
| Formula at pH 7.2 (Predicted) | C16H11O5- |
| Molecular Weight | 284.268 |
| Structure |  |
| SMILES | COc1ccc(c(c1)O)c1coc2c(c1=O)ccc(c2)O; COC1=CC(=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O |
| Reactions | OSR2136 OSR2159 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00943 |
| Metacyc | PWY-2463 PWY-2464 |