RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1136 |
| Common Name | Guanosine |
| Formula | C10H13N5O5 |
| Formula at pH 7.2 (Predicted) | C10H13N5O5 |
| Molecular Weight | 283.241 |
| Structure |  |
| SMILES | C(O)[CH]1(O[CH]([CH](O)[CH]1O)n2(c3(c(nc2)c(=O)[nH]c(n3)N))) |
| Reactions | OSR0535 OSR0542 OSR0646 OSR0654 OSR1407 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00387 |
| ChEBI | 16750 |