RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1138 |
| Common Name | N-Ribosylnicotinamide |
| Synonyms Names | 1-(beta-D-Ribofuranosyl)nicotinamide |
| Formula | C11H15N2O5 |
| Formula at pH 7.2 (Predicted) | C11H15N2O5+ |
| Molecular Weight | 255.247 |
| Structure |  |
| SMILES | c1([n+1](cccc1C(N)=O)[CH]2([CH](O)[CH](O)[CH](O2)CO)) |
| Reactions | OSR0515 OSR0644 OSR1397 |
| Pathways | |
|---|---|
| KEGG | rn00760 |
| Database Links | |
|---|---|
| KEGG | C03150 |
| ChEBI | 15927 |