RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1146 |
| Common Name | Aminoimidazole ribotide |
| Synonyms Names | AIR ;1-(5'-Phosphoribosyl)-5-aminoimidazole ;5'-Phosphoribosyl-5-aminoimidazole ;1-(5-Phospho-D-ribosyl)-5-aminoimidazole ;5-Amino-1-(5-phospho-D-ribosyl)imidazole |
| Formula | C8H14N3O7P |
| Formula at pH 7.2 (Predicted) | C8H13N3O7P- |
| Molecular Weight | 295.186 |
| Structure |  |
| SMILES | NC1=CN=C[N]1C2OC(CO[P](O)(O)=O)C(O)C2O |
| Reactions | OSR0333 OSR0374 OSR0536 OSR1500 OSR2443 |
| Pathways | |
|---|---|
| KEGG | rn00730 rn01100 rn00230 rn01110 |
| Metacyc | PWY-841 DENOVOPURINE2-PWY |
| Database Links | |
|---|---|
| KEGG | C03373 |
| ChEBI | 28843 |