RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1147 |
| Common Name | dUMP |
| Synonyms Names | Deoxyuridylic acid ;Deoxyuridine monophosphate ;Deoxyuridine 5'-phosphate ;2'-Deoxyuridine 5'-phosphate |
| Formula | C9H13N2O8P |
| Formula at pH 7.2 (Predicted) | C9H11N2O8P2- |
| Molecular Weight | 308.182 |
| Structure |  |
| SMILES | c1(n(c(=O)[nH]c(c1)=O)C2(OC(C(C2)O)COP(O)(O)=O)) |
| Reactions | OSR0549 OSR1289 OSR1414 OSR1609 OSR1778 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00670 |
| Metacyc | PWY0-181 PWY0-166 1CMET2-PWY P1-PWY PWY-3841 |
| Database Links | |
|---|---|
| KEGG | C00365 |
| ChEBI | 17622 |