RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1149 |
| Common Name | Plasmenylethanolamine |
| Synonyms Names | Ethanolamineplasmalogen ;Phosphatidalethanolamine ;C04756 ;2-Acyl-1-(1-alkenyl)-sn-glycero-3-phosphoethanolamine ;O-1-Alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine |
| Formula | C8H14NO7PR2 |
| Formula at pH 7.2 (Predicted) | C8H14NO7PR23- |
| Structure |  |
| SMILES | NCCO[P](O)(=O)OCC(COC=C[R])OC(=O)[R] |
| Reactions | OSR0512 OSR0527 OSR0529 OSR1142 |
| Pathways | |
|---|---|
| KEGG | rn00565 rn01100 |
| Database Links | |
|---|---|
| KEGG | C04756 |
| Pubchem Substance | 7325 |