RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1150 |
| Common Name | 5-Fluorodeoxyuridine monophosphate |
| Formula | C9H12FN2O8P |
| Formula at pH 7.2 (Predicted) | C9H10FN2O8P2- |
| Molecular Weight | 326.172 |
| Structure |  |
| SMILES | OC1CC(OC1COP(=O)(O)O)n1cc(F)c(=O)[nH]c1=O |
| Reactions | OSR1283 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C04242 |
| Pubchem Compound | 8642 |
| Pubchem Substance | 6908 |