RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1154 |
| Common Name | Taxifolin |
| Synonyms Names | Dihydroquercetin ;(+)-Dihydroquercetin ;(+)-Taxifolin ;trans-Dihydroquercetin |
| Formula | C15H12O7 |
| Formula at pH 7.2 (Predicted) | C15H12O7 |
| Molecular Weight | 304.252 |
| Structure |  |
| SMILES | c1(cc(cc(O)c1O)C2(C(O)C(=O)c3(c(O2)cc(O)cc3O))) |
| Reactions | OSR0803 OSR0808 OSR0812 OSR0841 OSR0906 OSR2172 OSR2205 OSR2212 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00941 rn01100 rn00944 |
| Metacyc | PWY-5125 PWY-3101 PWY-5152 PWY1F-823 PWY-5060 |
| Database Links | |
|---|---|
| Gramene | CPD-474 |
| KEGG | C01617 |
| ChEBI | 17948 |