RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1157 |
| Common Name | Afzelechin |
| Synonyms Names | 3,5,7,4'-Tetrahydroxyflavan |
| Formula | C15H14O5 |
| Formula at pH 7.2 (Predicted) | C15H14O5 |
| Molecular Weight | 274.269 |
| Structure |  |
| SMILES | c1(ccc(O)cc1)C2(C(O)Cc3(c(O)cc(O)cc(O2)3)) |
| Reactions | OSR1145 OSR2198 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY-641 |
| Database Links | |
|---|---|
| Gramene | CPD-1962 |
| KEGG | C09320 |
| Pubchem Compound | 442154 |
| Pubchem Substance | 11511 |