RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1159 |
| Common Name | 5-Deoxyleucopelargonidin |
| Formula | C15H14O5 |
| Formula at pH 7.2 (Predicted) | C15H14O5 |
| Molecular Weight | 274.269 |
| Structure |  |
| SMILES | Oc1ccc(cc1)C1Oc2cc(O)ccc2C(C1O)O |
| Reactions | OSR2109 |
| Pathways | |
|---|---|
| KEGG | rn00941 |
| Database Links | |
|---|---|
| KEGG | C16415 |
| Pubchem Compound | 13886897 |
| Pubchem Substance | 47205713 |