RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1161 |
| Common Name | 1,2-Bis(4-hydroxyphenyl)-2-propanol |
| Formula | C15H16O3 |
| Formula at pH 7.2 (Predicted) | C15H16O3 |
| Molecular Weight | 244.286 |
| Structure |  |
| SMILES | Oc1ccc(cc1)CC(c1ccc(cc1)O)(O)C |
| Reactions | OSR2079 |
| Pathways | |
|---|---|
| KEGG | rn00363 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C13629 |
| ChEBI | 31035 |
| Pubchem Compound | 656691 |
| Pubchem Substance | 586246 |