RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1166 |
| Common Name | Kaempferide |
| Synonyms Names | Kaempferol 4'-methyl ether |
| Formula | C16H12O6 |
| Formula at pH 7.2 (Predicted) | C16H11O6- |
| Molecular Weight | 300.263 |
| Structure |  |
| SMILES | COc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Reactions | OSR1409 |
| Pathways | |
|---|---|
| KEGG | rn00944 |
| Database Links | |
|---|---|
| KEGG | C10098 |
| ChEBI | 6099 |
| Pubchem Compound | 5281666 |
| Pubchem Substance | 12284 |