RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1171 |
| Common Name | 5-O-(1-Carboxyvinyl)-3-phosphoshikimate |
| Synonyms Names | O5-(1-Carboxyvinyl)-3-phosphoshikimate ;5-enolpyruvylshikimate 3-phosphate |
| Formula | C10H13O10P |
| Formula at pH 7.2 (Predicted) | C10H9O10P4- |
| Molecular Weight | 324.178 |
| Structure |  |
| SMILES | C(=O)(O)C1([CH2][CH](OC(=C)C(=O)O)[CH](O)[CH]([CH]=1)OP(O)(O)=O) |
| Reactions | OSR0490 OSR1687 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 |
| Metacyc | ARO-PWY PWY-6163 |
| Database Links | |
|---|---|
| KEGG | C01269 |
| ChEBI | 16257 |