RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1176 |
| Common Name | beta-D-Fructose 2,6-bisphosphate |
| Synonyms Names | D-Fructose 2,6-bisphosphate |
| Formula | C6H14O12P2 |
| Formula at pH 7.2 (Predicted) | C6H10O12P24- |
| Molecular Weight | 340.116 |
| Structure |  |
| SMILES | C(O)C1(OC(C(O)C(O)1)COP(=O)(O)O)(OP(O)(=O)O) |
| Reactions | OSR0553 OSR1315 |
| Pathways | |
|---|---|
| KEGG | rn00051 |
| Database Links | |
|---|---|
| Gramene | CPD-535 |
| KEGG | C00665 |
| ChEBI | 28602 |
| Pubchem Compound | 105021 |
| Pubchem Substance | 3934 |