RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1178 |
| Common Name | beta-D-Fructose 1,6-bisphosphate |
| Formula | C6H14O12P2 |
| Formula at pH 7.2 (Predicted) | C6H10O12P24- |
| Molecular Weight | 340.116 |
| Structure |  |
| SMILES | OC1C(COP(=O)(O)O)OC(C1O)(O)COP(=O)(O)O |
| Reactions | OSR0494 OSR0556 OSR0656 OSR1316 |
| Pathways | |
|---|---|
| KEGG | rn00010 rn00030 rn00051 rn01100 rn01110 rn01120 rn00680 |
| Database Links | |
|---|---|
| KEGG | C05378 |
| ChEBI | 28013 |
| Pubchem Compound | 10267 |
| Pubchem Substance | 7752 |