RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1183 |
| Common Name | Phosphatidylglycerol |
| Synonyms Names | 3-(3-sn-Phosphatidyl)glycerol ;3(3-Phosphatidyl-)glycerol ;PtdGro |
| Formula | C8H13O10PR2 |
| Formula at pH 7.2 (Predicted) | C8H12O1PR2 |
| Structure |  |
| SMILES | OCC(O)CO[P](O)(=O)OCC(COC(=O)[R])OC(=O)[R] |
| Reactions | OSR0550 OSR0660 OSR0811 OSR1603 OSR2250 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00344 |
| Pubchem Substance | 3637 |