RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1186 |
| Common Name | dCMP |
| Synonyms Names | Deoxycytidylic acid ;Deoxycytidine monophosphate ;Deoxycytidylate ;2'-Deoxycytidine 5'-monophosphate |
| Formula | C9H14N3O7P |
| Formula at pH 7.2 (Predicted) | C9H12N3O7P2- |
| Molecular Weight | 307.197 |
| Structure |  |
| SMILES | OC1CC(OC1COP(=O)(O)O)n1ccc(nc1=O)N |
| Reactions | OSR0549 OSR0560 OSR1433 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00239 |
| ChEBI | 15918 |
| Pubchem Compound | 13945 |
| Pubchem Substance | 3538 |