RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1187 |
| Common Name | gamma-Glutamyl-Se-methylselenocysteine |
| Synonyms Names | 5-L-Glutamyl-Se-methylselenocysteine |
| Formula | C9H16N2O5Se |
| Formula at pH 7.2 (Predicted) | C9H15N2O5Se- |
| Molecular Weight | 311.194 |
| Structure |  |
| SMILES | C[Se]CC(NC(=O)CCC(N)C(O)=O)C(O)=O |
| Reactions | OSR0700 |
| Database Links | |
|---|---|
| KEGG | C05695 |
| Pubchem Compound | 49787003 |
| Pubchem Substance | 8002 |