RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1191 |
| Common Name | S-Acetyldihydrolipoamide-E |
| Synonyms Names | C16255 ;[Dihydrolipoyllysine-residue acetyltransferase] S-acetyldihydrolipoyllysine |
| Formula | C10H18NO2S2R |
| Formula at pH 7.2 (Predicted) | C1H18NO2S2R- |
| Structure |  |
| SMILES | CC(=O)SCCC(S)CCCCC(N[R])=O |
| Reactions | OSR0545 OSR1375 OSR2243 |
| Pathways | |
|---|---|
| KEGG | rn00010 rn00020 rn00620 rn01110 rn01120 |
| Database Links | |
|---|---|
| KEGG | C16255 |
| Pubchem Substance | 47205563 |