RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1198 |
| Common Name | Dihydromyricetin |
| Synonyms Names | Ampelopsin ;(+)-Dihydromyricetin ;(+)-Ampelopsin |
| Formula | C15H12O8 |
| Formula at pH 7.2 (Predicted) | C15H12O8 |
| Molecular Weight | 320.251 |
| Structure |  |
| SMILES | c3(c2(OC(c1(cc(O)c(O)c(O)c1))C(O)C(=O)c2c(O)cc(O)3)) |
| Reactions | OSR0827 OSR0887 OSR2197 OSR2200 OSR2212 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY-5152 |
| Database Links | |
|---|---|
| Gramene | CPD-7087 |
| KEGG | C02906 |
| ChEBI | 28429 |
| Pubchem Compound | 161557 |
| Pubchem Substance | 5833 |