RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1200 |
| Common Name | 2,3-trans-catechin |
| Synonyms Names | (+)-Catechin ;D-Catechin ;Cyanidanol ;(2R-trans)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol ;(2R,3S)-Catechin ;(2R,3S)-(+)-Catechin ;Cianidanol |
| Formula | C15H14O6 |
| Formula at pH 7.2 (Predicted) | C15H14O6 |
| Molecular Weight | 290.272 |
| Structure |  |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
| Reactions | OSR1145 OSR2217 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY-641 |
| Database Links | |
|---|---|
| Gramene | CPD-1961 |
| KEGG | C06562 |
| ChEBI | 15600 |
| Pubchem Compound | 9064 |
| Pubchem Substance | 8791 |