RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1202 |
| Common Name | (-)-Epicatechin |
| Formula | C15H14O6 |
| Formula at pH 7.2 (Predicted) | C15H14O6 |
| Molecular Weight | 290.268 |
| Structure |  |
| SMILES | OC1CC2=C(OC1C3=CC(=C(O)C=C3)O)C=C(O)C=C2O |
| Reactions | OSR2130 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Database Links | |
|---|---|
| KEGG | C09727 |
| ChEBI | 17948 |
| Pubchem Compound | 72276 |
| Pubchem Substance | 11915 |