RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1205 |
| Common Name | 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol |
| Formula | C15H16O4 |
| Formula at pH 7.2 (Predicted) | C15H16O4 |
| Molecular Weight | 260.285 |
| Structure |  |
| SMILES | OCC(c1ccc(cc1)O)(Cc1ccc(cc1)O)O |
| Reactions | OSR2093 |
| Pathways | |
|---|---|
| KEGG | rn00363 rn01120 |
| Database Links | |
|---|---|
| KEGG | C13634 |
| Pubchem Compound | 656695 |
| Pubchem Substance | 586250 |