RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1207 |
| Common Name | 3',4',5,7-Tetrahydroxy-3-methoxyflavone |
| Synonyms Names | 3-Methoxy-5,7,3',4'-tetrahydroxyflavone ;3-O-Methylquercetin |
| Formula | C16H12O7 |
| Formula at pH 7.2 (Predicted) | C16H11O7- |
| Molecular Weight | 316.262 |
| Structure |  |
| SMILES | COc2(c(c1(cc(O)c(O)cc1))oc3(c(c2=O)c(O)cc(c3)O)) |
| Reactions | OSR2416 |
| Pathways | |
|---|---|
| KEGG | rn00944 |
| Database Links | |
|---|---|
| KEGG | C04443 |
| ChEBI | 16860 |
| Pubchem Compound | 5280681 |
| Pubchem Substance | 7072 |