RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1208 |
| Common Name | isorhamnetin |
| Formula | C16H12O7 |
| Formula at pH 7.2 (Predicted) | C16H11O7- |
| Molecular Weight | 316.267 |
| Structure |  |
| SMILES | COc1cc(ccc1O)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Reactions | OSR1426 OSR2238 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00944 rn01100 |
| Metacyc | PWY-6360 PWY-5320 PWY-5348 PWY-5321 |
| Database Links | |
|---|---|
| Gramene | CPD-8004 |
| Pubchem Compound | 5281654 |