RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1212 |
| Common Name | 3-beta-D-Galactosyl-sn-glycerol |
| Synonyms Names | Galactosylglycerol |
| Formula | C9H18O8 |
| Formula at pH 7.2 (Predicted) | C9H18O8 |
| Molecular Weight | 254.234 |
| Structure |  |
| SMILES | OCC(COC1OC(CO)C(C(C1O)O)O)O |
| Reactions | OSR0577 OSR0670 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00561 |
| Database Links | |
|---|---|
| KEGG | C05401 |
| ChEBI | 15754 |
| Pubchem Compound | 16048618 |
| Pubchem Substance | 7768 |