RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1219 |
| Common Name | 3-Deoxy-D-manno-octulosonate 8-phosphate |
| Synonyms Names | 2-Dehydro-3-deoxy-D-octonate 8-phosphate |
| Formula | C8H15O11P |
| Formula at pH 7.2 (Predicted) | C8H12O11P3- |
| Molecular Weight | 318.172 |
| Structure |  |
| SMILES | C(OP(O)(O)=O)C(O)C(O)C(O)C(O)CC(=O)C(O)=O |
| Reactions | OSR0572 OSR0679 |
| Pathways | |
|---|---|
| KEGG | rn00540 rn01100 |
| Metacyc | PWY-5111 |
| Database Links | |
|---|---|
| KEGG | C04478 |
| ChEBI | 18069 |