RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1222 |
| Common Name | 2'-Deoxyinosine 5'-phosphate |
| Synonyms Names | dIMP |
| Formula | C10H13N4O7P |
| Formula at pH 7.2 (Predicted) | C10H10N4O7P3- |
| Molecular Weight | 332.207 |
| Structure |  |
| SMILES | OC1CC(OC1COP(=O)(O)O)n1cnc2c1[nH]cnc2=O |
| Reactions | OSR0755 |
| Pathways | |
|---|---|
| KEGG | rn00230 |
| Database Links | |
|---|---|
| KEGG | C06196 |
| ChEBI | 28806 |
| Pubchem Compound | 91531 |
| Pubchem Substance | 8446 |