RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1224 |
| Common Name | Thiamine |
| Synonyms Names | Thiamin ;Vitamin B1 ;Aneurin ;Antiberiberi factor |
| Formula | C12H17N4OS |
| Formula at pH 7.2 (Predicted) | C12H17N4OS+ |
| Molecular Weight | 265.355 |
| Structure |  |
| SMILES | c1(c(cnc(C)n1)C[n+1]2(c(C)c(sc2)CCO))(N) |
| Reactions | OSR1445 OSR1449 |
| Pathways | |
|---|---|
| KEGG | rn00730 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00378 |
| ChEBI | 18385 |