RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1228 |
| Common Name | N-Acetyl-alpha-D-glucosamine 1-phosphate |
| Formula | C8H16NO9P |
| Formula at pH 7.2 (Predicted) | C8H14NO9P2- |
| Molecular Weight | 301.188 |
| Structure |  |
| SMILES | CC(=O)NC1(C(OP(O)(O)=O)OC(CO)C(O)C1O) |
| Reactions | OSR0499 OSR1383 |
| Pathways | |
|---|---|
| KEGG | rn00520 rn01110 rn01100 |
| Metacyc | UDPNACETYLGALSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C04501 |
| ChEBI | 16446 |
| Pubchem Compound | 440364 |
| Pubchem Substance | 7115 |