RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1235 |
| Common Name | Leucocyanidin |
| Synonyms Names | 2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol ;3,3',4,4',5,7-Flavanhexol ;3,4-Cyanidiol ;Leucoanthocyanidol ;Leucocianidol ;Leucocyanidol ;Leukocyanidine ;Procyanidol ;Resivit ;2,3-trans-3,4-cis-Leucocyanidin |
| Formula | C15H14O7 |
| Formula at pH 7.2 (Predicted) | C15H14O7 |
| Molecular Weight | 306.267 |
| Structure |  |
| SMILES | OC1C(O)C2=C(OC1C3=CC(=C(O)C=C3)O)C=C(O)C=C2O |
| Reactions | OSR0892 OSR0894 OSR0906 OSR2172 OSR2217 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 rn01100 |
| Metacyc | PWY-5125 PWY1F-823 PWY-5152 PWY-641 |
| Database Links | |
|---|---|
| Gramene | CPD-590 |
| KEGG | C05906 |
| ChEBI | 15758 |
| Pubchem Compound | 440833 |
| Pubchem Substance | 8194 |