RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1236 |
| Common Name | (+)-Gallocatechin |
| Synonyms Names | Gallocatechol |
| Formula | C15H14O7 |
| Formula at pH 7.2 (Predicted) | C15H14O7 |
| Molecular Weight | 306.267 |
| Structure |  |
| SMILES | Oc1cc2OC(c3cc(O)c(c(c3)O)O)C(Cc2c(c1)O)O |
| Reactions | OSR2225 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Database Links | |
|---|---|
| KEGG | C12127 |
| Pubchem Compound | 65084 |
| Pubchem Substance | 14274 |