RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1246 |
| Common Name | 4-nitrophenyl-beta-D-glucopyranoside |
| Formula | C12H15NO8 |
| Formula at pH 7.2 (Predicted) | C12H15NO8 |
| Structure |  |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O |
| Reactions | OSR0593 OSR0596 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn00460 rn00940 rn00500 |
| Metacyc | PWY-5176 PWY-4441 PWY-3121 PWY-6002 |