RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1252 |
| Common Name | inositol_1,4,5-trisphosphate |
| Formula | C6H12O15P3 |
| Formula at pH 7.2 (Predicted) | C6H9O15P36- |
| Structure |  |
| SMILES | OC1(C(C(C(C(C1OP(=O)(O)[O-])O)OP(=O)(O)[O-])OP(=O)(O)[O-])O) |
| Reactions | OSR0621 OSR0941 OSR1460 |
| Pathways | |
|---|---|
| Metacyc | LIPASYN-PWY |