RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1256 |
| Common Name | dAMP |
| Synonyms Names | 2'-Deoxyadenosine 5'-phosphate ;2'-Deoxyadenosine 5'-monophosphate ;Deoxyadenylic acid ;Deoxyadenosine monophosphate |
| Formula | C10H14N5O6P |
| Formula at pH 7.2 (Predicted) | C10H12N5O6P2- |
| Molecular Weight | 331.222 |
| Structure |  |
| SMILES | OC1CC(OC1COP(=O)(O)O)n1cnc2c1ncnc2N |
| Reactions | OSR0613 OSR1469 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00360 |
| ChEBI | 17713 |
| Pubchem Compound | 12599 |
| Pubchem Substance | 3651 |