RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1257 |
| Common Name | dTMP |
| Synonyms Names | Thymidine 5'-phosphate ;Deoxythymidine 5'-phosphate ;Thymidylic acid ;5'-Thymidylic acid ;Thymidine monophosphate ;Deoxythymidylic acid ;Thymidylate |
| Formula | C10H15N2O8P |
| Formula at pH 7.2 (Predicted) | C10H13N2O8P2- |
| Molecular Weight | 322.209 |
| Structure |  |
| SMILES | Cc1(cn(c(=O)[nH]c1=O)C2(OC(C(C2)O)COP(O)(O)=O)) |
| Reactions | OSR0584 OSR0693 OSR1464 OSR1609 OSR2380 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00670 |
| Metacyc | PWY0-166 P1-PWY 1CMET2-PWY PWY-3841 PWY0-181 |
| Database Links | |
|---|---|
| KEGG | C00364 |
| ChEBI | 17013 |