RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1266 |
| Common Name | Leucodelphinidin |
| Formula | C15H14O8 |
| Formula at pH 7.2 (Predicted) | C15H14O8 |
| Molecular Weight | 322.267 |
| Structure |  |
| SMILES | c3(c2(OC(c1(cc(O)c(O)c(O)c1))C(O)C(O)c2c(O)cc(O)3)) |
| Reactions | OSR0916 OSR0918 OSR2200 OSR2225 |
| Pathways | |
|---|---|
| KEGG | rn00941 rn01110 |
| Metacyc | PWY-5152 |
| Database Links | |
|---|---|
| Gramene | CPD-7088 |
| KEGG | C05909 |
| Pubchem Compound | 440835 |
| Pubchem Substance | 8197 |