RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1269 |
| Common Name | Dihydropteroate |
| Synonyms Names | 7,8-Dihydropteroate ;7,8-dihydropteroate |
| Formula | C14H14N6O3 |
| Formula at pH 7.2 (Predicted) | C14H13N6O3- |
| Molecular Weight | 314.299 |
| Structure |  |
| SMILES | NC1=NC2=C(N=C(CNC3=CC=C(C=C3)C(O)=O)CN2)C(=O)N1 |
| Reactions | OSR0628 OSR0783 OSR1963 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Metacyc | FOLSYN-PWY PWY-3742 |
| Database Links | |
|---|---|
| KEGG | C00921 |
| ChEBI | 4581 |